C21H27ClO4 — CID 143209501
2-[4-chloro-3-[(2Z,4E)-5-methoxy-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phenyl]-6-(hydroxymethyl)oxan-4-ol (PubChem CID 143209501) has the molecular formula C21H27ClO4 and a molecular weight of 378.90 g/mol. Its IUPAC name is 2-[4-chloro-3-[(2Z,4E)-5-methoxy-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phenyl]-6-(hydroxymethyl)oxan-4-ol.
| Compound Name | 2-[4-chloro-3-[(2Z,4E)-5-methoxy-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phenyl]-6-(hydroxymethyl)oxan-4-ol |
|---|---|
| PubChem CID | 143209501 |
| Molecular Formula | C21H27ClO4 |
| Molecular Weight | 378.90 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | 2-[4-chloro-3-[(2Z,4E)-5-methoxy-2-[(Z)-prop-1-enyl]penta-2,4-dienyl]phenyl]-6-(hydroxymethyl)oxan-4-ol |
| SMILES | C/C=C\C(=C/C=C/OC)Cc1cc(C2CC(O)CC(CO)O2)ccc1Cl |
| InChI | InChI=1S/C21H27ClO4/c1-3-5-15(6-4-9-25-2)10-17-11-16(7-8-20(17)22)21-13-18(24)12-19(14-23)26-21/h3-9,11,18-19,21,23-24H,10,12-14H2,1-2H3/b5-3-,9-4+,15-6+ |
| InChIKey | KRUYDMLRPUHXGS-HQHKTLMISA-N |
| XLogP | 4.12 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.90 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|