About 4-hydroxy-6-methyl-3,4-dihydro-1H-pyrimidin-2-one
4-hydroxy-6-methyl-3,4-dihydro-1H-pyrimidin-2-one (PubChem CID 143209867) has the molecular formula C5H8N2O2
and a molecular weight of 128.13 g/mol. Its IUPAC name is 4-hydroxy-6-methyl-3,4-dihydro-1H-pyrimidin-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-6-methyl-3,4-dihydro-1H-pyrimidin-2-one |
| PubChem CID | 143209867 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 4-hydroxy-6-methyl-3,4-dihydro-1H-pyrimidin-2-one |
| SMILES | CC1=CC(O)NC(=O)N1 |
| InChI | InChI=1S/C5H8N2O2/c1-3-2-4(8)7-5(9)6-3/h2,4,8H,1H3,(H2,6,7,9) |
| InChIKey | VWDHMRKEEPRZOW-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-hydroxy-6-methyl-3,4-dihydro-1H-pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-6-methyl-3,4-dihydro-1H-pyrimidin-2-one?
The IUPAC name of 4-hydroxy-6-methyl-3,4-dihydro-1H-pyrimidin-2-one (CID 143209867) is 4-hydroxy-6-methyl-3,4-dihydro-1H-pyrimidin-2-one.
What is the SMILES notation for 4-hydroxy-6-methyl-3,4-dihydro-1H-pyrimidin-2-one?
The canonical SMILES for 4-hydroxy-6-methyl-3,4-dihydro-1H-pyrimidin-2-one is CC1=CC(O)NC(=O)N1.
What is the InChIKey of 4-hydroxy-6-methyl-3,4-dihydro-1H-pyrimidin-2-one?
The InChIKey is VWDHMRKEEPRZOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O2/c1-3-2-4(8)7-5(9)6-3/h2,4,8H,1H3,(H2,6,7,9).
What are the key properties of 4-hydroxy-6-methyl-3,4-dihydro-1H-pyrimidin-2-one?
4-hydroxy-6-methyl-3,4-dihydro-1H-pyrimidin-2-one has a molecular weight of 128.13 g/mol, XLogP of -0.48, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-6-methyl-3,4-dihydro-1H-pyrimidin-2-one is sourced from PubChem (CID 143209867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).