C19H27IO2 — CID 143210120
4-[4-[2-(6-iodooxan-3-yl)ethyl]phenyl]cyclohexan-1-ol (PubChem CID 143210120) has the molecular formula C19H27IO2 and a molecular weight of 414.33 g/mol. Its IUPAC name is 4-[4-[2-(6-iodooxan-3-yl)ethyl]phenyl]cyclohexan-1-ol.
| Compound Name | 4-[4-[2-(6-iodooxan-3-yl)ethyl]phenyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 143210120 |
| Molecular Formula | C19H27IO2 |
| Molecular Weight | 414.33 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 4-[4-[2-(6-iodooxan-3-yl)ethyl]phenyl]cyclohexan-1-ol |
| SMILES | OC1CCC(c2ccc(CCC3CCC(I)OC3)cc2)CC1 |
| InChI | InChI=1S/C19H27IO2/c20-19-12-5-15(13-22-19)2-1-14-3-6-16(7-4-14)17-8-10-18(21)11-9-17/h3-4,6-7,15,17-19,21H,1-2,5,8-13H2 |
| InChIKey | USKPPQOJRZVBGT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.33 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|