C14H24O — CID 143210182
2-ethenyl-5-(4-methylcyclohexyl)oxane (PubChem CID 143210182) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 2-ethenyl-5-(4-methylcyclohexyl)oxane.
| Compound Name | 2-ethenyl-5-(4-methylcyclohexyl)oxane |
|---|---|
| PubChem CID | 143210182 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 2-ethenyl-5-(4-methylcyclohexyl)oxane |
| SMILES | C=CC1CCC(C2CCC(C)CC2)CO1 |
| InChI | InChI=1S/C14H24O/c1-3-14-9-8-13(10-15-14)12-6-4-11(2)5-7-12/h3,11-14H,1,4-10H2,2H3 |
| InChIKey | KJXNZWZEFOFBOJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|