C13H4ClF4NO — CID 14321062
6-chloro-7,8,9,10-tetrafluorobenzo[b][1,4]benzoxazepine (PubChem CID 14321062) has the molecular formula C13H4ClF4NO and a molecular weight of 301.63 g/mol. Its IUPAC name is 6-chloro-7,8,9,10-tetrafluorobenzo[b][1,4]benzoxazepine.
| Compound Name | 6-chloro-7,8,9,10-tetrafluorobenzo[b][1,4]benzoxazepine |
|---|---|
| PubChem CID | 14321062 |
| Molecular Formula | C13H4ClF4NO |
| Molecular Weight | 301.63 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | 6-chloro-7,8,9,10-tetrafluorobenzo[b][1,4]benzoxazepine |
| SMILES | Fc1c(F)c(F)c2c(c1F)Oc1ccccc1N=C2Cl |
| InChI | InChI=1S/C13H4ClF4NO/c14-13-7-8(15)9(16)10(17)11(18)12(7)20-6-4-2-1-3-5(6)19-13/h1-4H |
| InChIKey | MQRCERDZYASPSY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|