C14H18O3 — CID 143210948
(2Z,4E)-5-(4-hydroxy-2,6-dimethyl-3-oxocyclohexen-1-yl)-3-methylpenta-2,4-dienal (PubChem CID 143210948) has the molecular formula C14H18O3 and a molecular weight of 234.30 g/mol. Its IUPAC name is (2Z,4E)-5-(4-hydroxy-2,6-dimethyl-3-oxocyclohexen-1-yl)-3-methylpenta-2,4-dienal.
| Compound Name | (2Z,4E)-5-(4-hydroxy-2,6-dimethyl-3-oxocyclohexen-1-yl)-3-methylpenta-2,4-dienal |
|---|---|
| PubChem CID | 143210948 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (2Z,4E)-5-(4-hydroxy-2,6-dimethyl-3-oxocyclohexen-1-yl)-3-methylpenta-2,4-dienal |
| SMILES | CC1=C(/C=C/C(C)=C\C=O)C(C)CC(O)C1=O |
| InChI | InChI=1S/C14H18O3/c1-9(6-7-15)4-5-12-10(2)8-13(16)14(17)11(12)3/h4-7,10,13,16H,8H2,1-3H3/b5-4+,9-6- |
| InChIKey | RPWLJSWWSSOVST-WEHQGULRSA-N |
| XLogP | 1.97 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|