C17H32O — CID 143211180
(3R)-2,2,3-trimethyl-3-(6-methylheptan-2-yl)cyclopentane-1-carbaldehyde (PubChem CID 143211180) has the molecular formula C17H32O and a molecular weight of 252.44 g/mol. Its IUPAC name is (3R)-2,2,3-trimethyl-3-(6-methylheptan-2-yl)cyclopentane-1-carbaldehyde.
| Compound Name | (3R)-2,2,3-trimethyl-3-(6-methylheptan-2-yl)cyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 143211180 |
| Molecular Formula | C17H32O |
| Molecular Weight | 252.44 g/mol |
| Exact Mass | 252.25 |
| IUPAC Name | (3R)-2,2,3-trimethyl-3-(6-methylheptan-2-yl)cyclopentane-1-carbaldehyde |
| SMILES | CC(C)CCCC(C)[C@@]1(C)CCC(C=O)C1(C)C |
| InChI | InChI=1S/C17H32O/c1-13(2)8-7-9-14(3)17(6)11-10-15(12-18)16(17,4)5/h12-15H,7-11H2,1-6H3/t14?,15?,17-/m1/s1 |
| InChIKey | AOBAZSWIANCCQA-VMBOVVBDSA-N |
| XLogP | 5.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.44 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|