About (3R)-2,2,3-trimethyl-3-(6-methylheptan-2-yl)cyclopentane-1-carbaldehyde
(3R)-2,2,3-trimethyl-3-(6-methylheptan-2-yl)cyclopentane-1-carbaldehyde (PubChem CID 143211180) has the molecular formula C17H32O
and a molecular weight of 252.44 g/mol. Its IUPAC name is (3R)-2,2,3-trimethyl-3-(6-methylheptan-2-yl)cyclopentane-1-carbaldehyde.
Molecular Properties
| Compound Name | (3R)-2,2,3-trimethyl-3-(6-methylheptan-2-yl)cyclopentane-1-carbaldehyde |
| PubChem CID | 143211180 |
| Molecular Formula | C17H32O |
| Molecular Weight | 252.44 g/mol |
| Exact Mass | 252.25 |
| IUPAC Name | (3R)-2,2,3-trimethyl-3-(6-methylheptan-2-yl)cyclopentane-1-carbaldehyde |
| SMILES | CC(C)CCCC(C)[C@@]1(C)CCC(C=O)C1(C)C |
| InChI | InChI=1S/C17H32O/c1-13(2)8-7-9-14(3)17(6)11-10-15(12-18)16(17,4)5/h12-15H,7-11H2,1-6H3/t14?,15?,17-/m1/s1 |
| InChIKey | AOBAZSWIANCCQA-VMBOVVBDSA-N |
| XLogP | 5.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.44 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3R)-2,2,3-trimethyl-3-(6-methylheptan-2-yl)cyclopentane-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2,2,3-trimethyl-3-(6-methylheptan-2-yl)cyclopentane-1-carbaldehyde?
The IUPAC name of (3R)-2,2,3-trimethyl-3-(6-methylheptan-2-yl)cyclopentane-1-carbaldehyde (CID 143211180) is (3R)-2,2,3-trimethyl-3-(6-methylheptan-2-yl)cyclopentane-1-carbaldehyde.
What is the SMILES notation for (3R)-2,2,3-trimethyl-3-(6-methylheptan-2-yl)cyclopentane-1-carbaldehyde?
The canonical SMILES for (3R)-2,2,3-trimethyl-3-(6-methylheptan-2-yl)cyclopentane-1-carbaldehyde is CC(C)CCCC(C)[C@@]1(C)CCC(C=O)C1(C)C.
What is the InChIKey of (3R)-2,2,3-trimethyl-3-(6-methylheptan-2-yl)cyclopentane-1-carbaldehyde?
The InChIKey is AOBAZSWIANCCQA-VMBOVVBDSA-N. The full InChI is InChI=1S/C17H32O/c1-13(2)8-7-9-14(3)17(6)11-10-15(12-18)16(17,4)5/h12-15H,7-11H2,1-6H3/t14?,15?,17-/m1/s1.
What are the key properties of (3R)-2,2,3-trimethyl-3-(6-methylheptan-2-yl)cyclopentane-1-carbaldehyde?
(3R)-2,2,3-trimethyl-3-(6-methylheptan-2-yl)cyclopentane-1-carbaldehyde has a molecular weight of 252.44 g/mol, XLogP of 5.09, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2,2,3-trimethyl-3-(6-methylheptan-2-yl)cyclopentane-1-carbaldehyde is sourced from PubChem (CID 143211180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).