C25H40F2O — CID 143211258
(6Z,8Z)-8,9-difluoro-5-methylidene-7-(4-pentylcycloheptyl)-2-propyl-2,3,4,10-tetrahydrooxecine (PubChem CID 143211258) has the molecular formula C25H40F2O and a molecular weight of 394.59 g/mol. Its IUPAC name is (6Z,8Z)-8,9-difluoro-5-methylidene-7-(4-pentylcycloheptyl)-2-propyl-2,3,4,10-tetrahydrooxecine.
| Compound Name | (6Z,8Z)-8,9-difluoro-5-methylidene-7-(4-pentylcycloheptyl)-2-propyl-2,3,4,10-tetrahydrooxecine |
|---|---|
| PubChem CID | 143211258 |
| Molecular Formula | C25H40F2O |
| Molecular Weight | 394.59 g/mol |
| Exact Mass | 394.30 |
| IUPAC Name | (6Z,8Z)-8,9-difluoro-5-methylidene-7-(4-pentylcycloheptyl)-2-propyl-2,3,4,10-tetrahydrooxecine |
| SMILES | C=C1/C=C(C2CCCC(CCCCC)CC2)\C(F)=C(\F)COC(CCC)CC1 |
| InChI | InChI=1S/C25H40F2O/c1-4-6-7-10-20-11-8-12-21(15-14-20)23-17-19(3)13-16-22(9-5-2)28-18-24(26)25(23)27/h17,20-22H,3-16,18H2,1-2H3/b23-17-,25-24- |
| InChIKey | RQYKZQNWKRPWLK-BCBFZKJFSA-N |
| XLogP | 8.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.59 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|