C23H32F2O — CID 143211271
4-ethenyl-1,2-difluoro-6-(4-pentylcyclohexyl)-3-prop-2-enoxycyclohepta-1,3,5-triene (PubChem CID 143211271) has the molecular formula C23H32F2O and a molecular weight of 362.50 g/mol. Its IUPAC name is 4-ethenyl-1,2-difluoro-6-(4-pentylcyclohexyl)-3-prop-2-enoxycyclohepta-1,3,5-triene.
| Compound Name | 4-ethenyl-1,2-difluoro-6-(4-pentylcyclohexyl)-3-prop-2-enoxycyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 143211271 |
| Molecular Formula | C23H32F2O |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 4-ethenyl-1,2-difluoro-6-(4-pentylcyclohexyl)-3-prop-2-enoxycyclohepta-1,3,5-triene |
| SMILES | C=CCOC1=C(C=C)C=C(C2CCC(CCCCC)CC2)CC(F)=C1F |
| InChI | InChI=1S/C23H32F2O/c1-4-7-8-9-17-10-12-19(13-11-17)20-15-18(6-3)23(26-14-5-2)22(25)21(24)16-20/h5-6,15,17,19H,2-4,7-14,16H2,1H3 |
| InChIKey | PGUHVXODAYKHPE-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|