C21H20N4O4 — CID 14321196
7,11-bis(4-methylphenyl)-2,4,8,10-tetrazaspiro[5.5]undecane-1,3,5,9-tetrone (PubChem CID 14321196) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is 7,11-bis(4-methylphenyl)-2,4,8,10-tetrazaspiro[5.5]undecane-1,3,5,9-tetrone.
| Compound Name | 7,11-bis(4-methylphenyl)-2,4,8,10-tetrazaspiro[5.5]undecane-1,3,5,9-tetrone |
|---|---|
| PubChem CID | 14321196 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 7,11-bis(4-methylphenyl)-2,4,8,10-tetrazaspiro[5.5]undecane-1,3,5,9-tetrone |
| SMILES | Cc1ccc(C2NC(=O)NC(c3ccc(C)cc3)C23C(=O)NC(=O)NC3=O)cc1 |
| InChI | InChI=1S/C21H20N4O4/c1-11-3-7-13(8-4-11)15-21(17(26)24-20(29)25-18(21)27)16(23-19(28)22-15)14-9-5-12(2)6-10-14/h3-10,15-16H,1-2H3,(H2,22,23,28)(H2,24,25,26,27,29) |
| InChIKey | LLJSRJURUFTWMF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|