C17H22O — CID 143212874
(3Z)-1-(3,4-dimethylcyclohexa-1,3-dien-1-yl)-4,5-dimethyl-2-methylidenehexa-3,5-dien-1-one (PubChem CID 143212874) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is (3Z)-1-(3,4-dimethylcyclohexa-1,3-dien-1-yl)-4,5-dimethyl-2-methylidenehexa-3,5-dien-1-one.
| Compound Name | (3Z)-1-(3,4-dimethylcyclohexa-1,3-dien-1-yl)-4,5-dimethyl-2-methylidenehexa-3,5-dien-1-one |
|---|---|
| PubChem CID | 143212874 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | (3Z)-1-(3,4-dimethylcyclohexa-1,3-dien-1-yl)-4,5-dimethyl-2-methylidenehexa-3,5-dien-1-one |
| SMILES | C=C(/C=C(/C)C(=C)C)C(=O)C1=CC(C)=C(C)CC1 |
| InChI | InChI=1S/C17H22O/c1-11(2)13(4)9-15(6)17(18)16-8-7-12(3)14(5)10-16/h9-10H,1,6-8H2,2-5H3/b13-9- |
| InChIKey | IQTKSIVAAYWEGH-LCYFTJDESA-N |
| XLogP | 4.69 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|