About 8a-methyl-2,6-dihydro-1H-azulen-6-ol
8a-methyl-2,6-dihydro-1H-azulen-6-ol (PubChem CID 14321294) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is 8a-methyl-2,6-dihydro-1H-azulen-6-ol.
Molecular Properties
| Compound Name | 8a-methyl-2,6-dihydro-1H-azulen-6-ol |
| PubChem CID | 14321294 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 8a-methyl-2,6-dihydro-1H-azulen-6-ol |
| SMILES | CC12C=CC(O)C=CC1=CCC2 |
| InChI | InChI=1S/C11H14O/c1-11-7-2-3-9(11)4-5-10(12)6-8-11/h3-6,8,10,12H,2,7H2,1H3 |
| InChIKey | OHBMCJQFPJNMLJ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8a-methyl-2,6-dihydro-1H-azulen-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8a-methyl-2,6-dihydro-1H-azulen-6-ol?
The IUPAC name of 8a-methyl-2,6-dihydro-1H-azulen-6-ol (CID 14321294) is 8a-methyl-2,6-dihydro-1H-azulen-6-ol.
What is the SMILES notation for 8a-methyl-2,6-dihydro-1H-azulen-6-ol?
The canonical SMILES for 8a-methyl-2,6-dihydro-1H-azulen-6-ol is CC12C=CC(O)C=CC1=CCC2.
What is the InChIKey of 8a-methyl-2,6-dihydro-1H-azulen-6-ol?
The InChIKey is OHBMCJQFPJNMLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O/c1-11-7-2-3-9(11)4-5-10(12)6-8-11/h3-6,8,10,12H,2,7H2,1H3.
What are the key properties of 8a-methyl-2,6-dihydro-1H-azulen-6-ol?
8a-methyl-2,6-dihydro-1H-azulen-6-ol has a molecular weight of 162.23 g/mol, XLogP of 2.20, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8a-methyl-2,6-dihydro-1H-azulen-6-ol is sourced from PubChem (CID 14321294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).