C20H24BrF5N4O — CID 143214001
3-[(4-bromo-3,6-difluorocyclohepta-1,3,5-trien-1-yl)methylamino]-1-[2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]propan-1-one;ethane (PubChem CID 143214001) has the molecular formula C20H24BrF5N4O and a molecular weight of 511.33 g/mol. Its IUPAC name is 3-[(4-bromo-3,6-difluorocyclohepta-1,3,5-trien-1-yl)methylamino]-1-[2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]propan-1-one;ethane.
| Compound Name | 3-[(4-bromo-3,6-difluorocyclohepta-1,3,5-trien-1-yl)methylamino]-1-[2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]propan-1-one;ethane |
|---|---|
| PubChem CID | 143214001 |
| Molecular Formula | C20H24BrF5N4O |
| Molecular Weight | 511.33 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | 3-[(4-bromo-3,6-difluorocyclohepta-1,3,5-trien-1-yl)methylamino]-1-[2-(trifluoromethyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]propan-1-one;ethane |
| SMILES | CC.O=C(CCNCC1=CC(F)=C(Br)C=C(F)C1)N1CCn2cc(C(F)(F)F)nc2C1 |
| InChI | InChI=1S/C18H18BrF5N4O.C2H6/c19-13-7-12(20)5-11(6-14(13)21)8-25-2-1-17(29)28-4-3-27-9-15(18(22,23)24)26-16(27)10-28;1-2/h6-7,9,25H,1-5,8,10H2;1-2H3 |
| InChIKey | HOSGTGZAJZLGTA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.33 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|