About 3,6-dimethyl-1,3-oxazepan-4-one
3,6-dimethyl-1,3-oxazepan-4-one (PubChem CID 143214106) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is 3,6-dimethyl-1,3-oxazepan-4-one.
Molecular Properties
| Compound Name | 3,6-dimethyl-1,3-oxazepan-4-one |
| PubChem CID | 143214106 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 3,6-dimethyl-1,3-oxazepan-4-one |
| SMILES | CC1COCN(C)C(=O)C1 |
| InChI | InChI=1S/C7H13NO2/c1-6-3-7(9)8(2)5-10-4-6/h6H,3-5H2,1-2H3 |
| InChIKey | UOASENHAPMDAFD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-dimethyl-1,3-oxazepan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dimethyl-1,3-oxazepan-4-one?
The IUPAC name of 3,6-dimethyl-1,3-oxazepan-4-one (CID 143214106) is 3,6-dimethyl-1,3-oxazepan-4-one.
What is the SMILES notation for 3,6-dimethyl-1,3-oxazepan-4-one?
The canonical SMILES for 3,6-dimethyl-1,3-oxazepan-4-one is CC1COCN(C)C(=O)C1.
What is the InChIKey of 3,6-dimethyl-1,3-oxazepan-4-one?
The InChIKey is UOASENHAPMDAFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-6-3-7(9)8(2)5-10-4-6/h6H,3-5H2,1-2H3.
What are the key properties of 3,6-dimethyl-1,3-oxazepan-4-one?
3,6-dimethyl-1,3-oxazepan-4-one has a molecular weight of 143.19 g/mol, XLogP of 0.46, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dimethyl-1,3-oxazepan-4-one is sourced from PubChem (CID 143214106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).