C27H24N2O — CID 143214514
N,N-dimethyl-4-(2-phenylindol-1-yl)cyclodeca-1,3,5,7,9-pentaene-1-carboxamide (PubChem CID 143214514) has the molecular formula C27H24N2O and a molecular weight of 392.50 g/mol. Its IUPAC name is N,N-dimethyl-4-(2-phenylindol-1-yl)cyclodeca-1,3,5,7,9-pentaene-1-carboxamide.
| Compound Name | N,N-dimethyl-4-(2-phenylindol-1-yl)cyclodeca-1,3,5,7,9-pentaene-1-carboxamide |
|---|---|
| PubChem CID | 143214514 |
| Molecular Formula | C27H24N2O |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | N,N-dimethyl-4-(2-phenylindol-1-yl)cyclodeca-1,3,5,7,9-pentaene-1-carboxamide |
| SMILES | CN(C)C(=O)c1ccccccc(-n2c(-c3ccccc3)cc3ccccc32)cc1 |
| InChI | InChI=1S/C27H24N2O/c1-28(2)27(30)22-14-6-3-4-9-16-24(19-18-22)29-25-17-11-10-15-23(25)20-26(29)21-12-7-5-8-13-21/h3-20H,1-2H3/b4-3+,6-3-,9-4+,14-6-,16-9-,19-18+,22-14+,22-18-,24-16+,24-19+ |
| InChIKey | ASTZVPRIYXRATE-ULQVXNRXSA-N |
| XLogP | 6.12 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |