C27H35NO2 — CID 143214591
ethane;formic acid;6-methyl-2-phenyl-1-(4-propylphenyl)-4,5,6,7-tetrahydroindole (PubChem CID 143214591) has the molecular formula C27H35NO2 and a molecular weight of 405.58 g/mol. Its IUPAC name is ethane;formic acid;6-methyl-2-phenyl-1-(4-propylphenyl)-4,5,6,7-tetrahydroindole.
| Compound Name | ethane;formic acid;6-methyl-2-phenyl-1-(4-propylphenyl)-4,5,6,7-tetrahydroindole |
|---|---|
| PubChem CID | 143214591 |
| Molecular Formula | C27H35NO2 |
| Molecular Weight | 405.58 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | ethane;formic acid;6-methyl-2-phenyl-1-(4-propylphenyl)-4,5,6,7-tetrahydroindole |
| SMILES | CC.CCCc1ccc(-n2c(-c3ccccc3)cc3c2CC(C)CC3)cc1.O=CO |
| InChI | InChI=1S/C24H27N.C2H6.CH2O2/c1-3-7-19-11-14-22(15-12-19)25-23-16-18(2)10-13-21(23)17-24(25)20-8-5-4-6-9-20;1-2;2-1-3/h4-6,8-9,11-12,14-15,17-18H,3,7,10,13,16H2,1-2H3;1-2H3;1H,(H,2,3) |
| InChIKey | MXQLMBNBUAYGBM-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.58 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|