C23H29NO2 — CID 143214644
(E)-4-(5-tert-butyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)-2-methylbut-2-enoic acid (PubChem CID 143214644) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is (E)-4-(5-tert-butyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)-2-methylbut-2-enoic acid.
| Compound Name | (E)-4-(5-tert-butyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 143214644 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (E)-4-(5-tert-butyl-2-phenyl-4,5,6,7-tetrahydroindol-1-yl)-2-methylbut-2-enoic acid |
| SMILES | C/C(=C\Cn1c(-c2ccccc2)cc2c1CCC(C(C)(C)C)C2)C(=O)O |
| InChI | InChI=1S/C23H29NO2/c1-16(22(25)26)12-13-24-20-11-10-19(23(2,3)4)14-18(20)15-21(24)17-8-6-5-7-9-17/h5-9,12,15,19H,10-11,13-14H2,1-4H3,(H,25,26)/b16-12+ |
| InChIKey | MAFLQPMQGNEDBR-FOWTUZBSSA-N |
| XLogP | 5.34 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|