C26H35N5 — CID 143214762
ethane;hydrazine;(Z,2E)-2-[2-(2-pyridin-4-yl-4,5-dihydrobenzo[e]indol-3-yl)ethylidene]pent-3-en-1-amine (PubChem CID 143214762) has the molecular formula C26H35N5 and a molecular weight of 417.60 g/mol. Its IUPAC name is ethane;hydrazine;(Z,2E)-2-[2-(2-pyridin-4-yl-4,5-dihydrobenzo[e]indol-3-yl)ethylidene]pent-3-en-1-amine.
| Compound Name | ethane;hydrazine;(Z,2E)-2-[2-(2-pyridin-4-yl-4,5-dihydrobenzo[e]indol-3-yl)ethylidene]pent-3-en-1-amine |
|---|---|
| PubChem CID | 143214762 |
| Molecular Formula | C26H35N5 |
| Molecular Weight | 417.60 g/mol |
| Exact Mass | 417.29 |
| IUPAC Name | ethane;hydrazine;(Z,2E)-2-[2-(2-pyridin-4-yl-4,5-dihydrobenzo[e]indol-3-yl)ethylidene]pent-3-en-1-amine |
| SMILES | C/C=C\C(=C/Cn1c(-c2ccncc2)cc2c1CCc1ccccc1-2)CN.CC.NN |
| InChI | InChI=1S/C24H25N3.C2H6.H4N2/c1-2-5-18(17-25)12-15-27-23-9-8-19-6-3-4-7-21(19)22(23)16-24(27)20-10-13-26-14-11-20;2*1-2/h2-7,10-14,16H,8-9,15,17,25H2,1H3;1-2H3;1-2H2/b5-2-,18-12+;; |
| InChIKey | ZINIQVQRXPGDJX-TUADXYPCSA-N |
| XLogP | 4.62 |
| TPSA | 95.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.60 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|