C21H33NO4 — CID 14321556
dimethyl 4,5,6-tritert-butylpyridine-2,3-dicarboxylate (PubChem CID 14321556) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is dimethyl 4,5,6-tritert-butylpyridine-2,3-dicarboxylate.
| Compound Name | dimethyl 4,5,6-tritert-butylpyridine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 14321556 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | dimethyl 4,5,6-tritert-butylpyridine-2,3-dicarboxylate |
| SMILES | COC(=O)c1nc(C(C)(C)C)c(C(C)(C)C)c(C(C)(C)C)c1C(=O)OC |
| InChI | InChI=1S/C21H33NO4/c1-19(2,3)13-12(17(23)25-10)15(18(24)26-11)22-16(21(7,8)9)14(13)20(4,5)6/h1-11H3 |
| InChIKey | AQTUAJPXTGARKZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |