C19H12ClF3N2O4 — CID 143215717
6-chloropyridine-3-carboxylic acid;6-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid (PubChem CID 143215717) has the molecular formula C19H12ClF3N2O4 and a molecular weight of 424.76 g/mol. Its IUPAC name is 6-chloropyridine-3-carboxylic acid;6-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid.
| Compound Name | 6-chloropyridine-3-carboxylic acid;6-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 143215717 |
| Molecular Formula | C19H12ClF3N2O4 |
| Molecular Weight | 424.76 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | 6-chloropyridine-3-carboxylic acid;6-[4-(trifluoromethyl)phenyl]pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(C(F)(F)F)cc2)nc1.O=C(O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C13H8F3NO2.C6H4ClNO2/c14-13(15,16)10-4-1-8(2-5-10)11-6-3-9(7-17-11)12(18)19;7-5-2-1-4(3-8-5)6(9)10/h1-7H,(H,18,19);1-3H,(H,9,10) |
| InChIKey | FYMJEUUEXWNVFV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.76 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|