C28H22N2O4S2 — CID 143216676
(E)-3-[1'-(naphthalen-2-ylmethyl)-2'-oxospiro[1,3-dioxolane-2,3'-indole]-7'-yl]-N-thiophen-2-ylsulfanylprop-2-enamide (PubChem CID 143216676) has the molecular formula C28H22N2O4S2 and a molecular weight of 514.63 g/mol. Its IUPAC name is (E)-3-[1'-(naphthalen-2-ylmethyl)-2'-oxospiro[1,3-dioxolane-2,3'-indole]-7'-yl]-N-thiophen-2-ylsulfanylprop-2-enamide.
| Compound Name | (E)-3-[1'-(naphthalen-2-ylmethyl)-2'-oxospiro[1,3-dioxolane-2,3'-indole]-7'-yl]-N-thiophen-2-ylsulfanylprop-2-enamide |
|---|---|
| PubChem CID | 143216676 |
| Molecular Formula | C28H22N2O4S2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | (E)-3-[1'-(naphthalen-2-ylmethyl)-2'-oxospiro[1,3-dioxolane-2,3'-indole]-7'-yl]-N-thiophen-2-ylsulfanylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccc2c1N(Cc1ccc3ccccc3c1)C(=O)C21OCCO1)NSc1cccs1 |
| InChI | InChI=1S/C28H22N2O4S2/c31-24(29-36-25-9-4-16-35-25)13-12-21-7-3-8-23-26(21)30(27(32)28(23)33-14-15-34-28)18-19-10-11-20-5-1-2-6-22(20)17-19/h1-13,16-17H,14-15,18H2,(H,29,31)/b13-12+ |
| InChIKey | YMMIUSPIFYMVTO-OUKQBFOZSA-N |
| XLogP | 5.48 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|