C27H37FO5SSi — CID 143216788
[(Z)-5-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)-2-methyl-3-(4-methylsulfonylphenyl)pent-3-en-2-yl] acetate (PubChem CID 143216788) has the molecular formula C27H37FO5SSi and a molecular weight of 520.74 g/mol. Its IUPAC name is [(Z)-5-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)-2-methyl-3-(4-methylsulfonylphenyl)pent-3-en-2-yl] acetate.
| Compound Name | [(Z)-5-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)-2-methyl-3-(4-methylsulfonylphenyl)pent-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 143216788 |
| Molecular Formula | C27H37FO5SSi |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | [(Z)-5-[tert-butyl(dimethyl)silyl]oxy-4-(3-fluorophenyl)-2-methyl-3-(4-methylsulfonylphenyl)pent-3-en-2-yl] acetate |
| SMILES | CC(=O)OC(C)(C)/C(=C(\CO[Si](C)(C)C(C)(C)C)c1cccc(F)c1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C27H37FO5SSi/c1-19(29)33-27(5,6)25(20-13-15-23(16-14-20)34(7,30)31)24(21-11-10-12-22(28)17-21)18-32-35(8,9)26(2,3)4/h10-17H,18H2,1-9H3/b25-24+ |
| InChIKey | QZSIPRVXFBMVAG-OCOZRVBESA-N |
| XLogP | 6.50 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|