C27H40Cl2N6OS — CID 143216877
N-(2,6-dichloro-4-pyridinyl)formamide;7-(dimethylaminosulfanyl)-N-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 143216877) has the molecular formula C27H40Cl2N6OS and a molecular weight of 567.63 g/mol. Its IUPAC name is N-(2,6-dichloro-4-pyridinyl)formamide;7-(dimethylaminosulfanyl)-N-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | N-(2,6-dichloro-4-pyridinyl)formamide;7-(dimethylaminosulfanyl)-N-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 143216877 |
| Molecular Formula | C27H40Cl2N6OS |
| Molecular Weight | 567.63 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | N-(2,6-dichloro-4-pyridinyl)formamide;7-(dimethylaminosulfanyl)-N-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CN1CCN(CCCN(C)C2CCc3ccc(SN(C)C)cc3C2)CC1.O=CNc1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C21H36N4S.C6H4Cl2N2O/c1-22(2)26-21-9-7-18-6-8-20(16-19(18)17-21)24(4)10-5-11-25-14-12-23(3)13-15-25;7-5-1-4(9-3-11)2-6(8)10-5/h7,9,17,20H,5-6,8,10-16H2,1-4H3;1-3H,(H,9,10,11) |
| InChIKey | DFPJSMSLANTXOD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 54.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.63 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|