About ethanimine;4-methyl-3-[3-(propylamino)propyl]-1H-imidazol-2-one
ethanimine;4-methyl-3-[3-(propylamino)propyl]-1H-imidazol-2-one (PubChem CID 143217146) has the molecular formula C12H24N4O
and a molecular weight of 240.35 g/mol. Its IUPAC name is ethanimine;4-methyl-3-[3-(propylamino)propyl]-1H-imidazol-2-one.
Molecular Properties
| Compound Name | ethanimine;4-methyl-3-[3-(propylamino)propyl]-1H-imidazol-2-one |
| PubChem CID | 143217146 |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | ethanimine;4-methyl-3-[3-(propylamino)propyl]-1H-imidazol-2-one |
| SMILES | CCCNCCCn1c(C)c[nH]c1=O.[H]/N=C/C |
| InChI | InChI=1S/C10H19N3O.C2H5N/c1-3-5-11-6-4-7-13-9(2)8-12-10(13)14;1-2-3/h8,11H,3-7H2,1-2H3,(H,12,14);2-3H,1H3/b;3-2+ |
| InChIKey | QKYWWNJIXSAZKD-ZPYUXNTASA-N |
| XLogP | 1.53 |
| TPSA | 73.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethanimine;4-methyl-3-[3-(propylamino)propyl]-1H-imidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanimine;4-methyl-3-[3-(propylamino)propyl]-1H-imidazol-2-one?
The IUPAC name of ethanimine;4-methyl-3-[3-(propylamino)propyl]-1H-imidazol-2-one (CID 143217146) is ethanimine;4-methyl-3-[3-(propylamino)propyl]-1H-imidazol-2-one.
What is the SMILES notation for ethanimine;4-methyl-3-[3-(propylamino)propyl]-1H-imidazol-2-one?
The canonical SMILES for ethanimine;4-methyl-3-[3-(propylamino)propyl]-1H-imidazol-2-one is CCCNCCCn1c(C)c[nH]c1=O.[H]/N=C/C.
What is the InChIKey of ethanimine;4-methyl-3-[3-(propylamino)propyl]-1H-imidazol-2-one?
The InChIKey is QKYWWNJIXSAZKD-ZPYUXNTASA-N. The full InChI is InChI=1S/C10H19N3O.C2H5N/c1-3-5-11-6-4-7-13-9(2)8-12-10(13)14;1-2-3/h8,11H,3-7H2,1-2H3,(H,12,14);2-3H,1H3/b;3-2+.
What are the key properties of ethanimine;4-methyl-3-[3-(propylamino)propyl]-1H-imidazol-2-one?
ethanimine;4-methyl-3-[3-(propylamino)propyl]-1H-imidazol-2-one has a molecular weight of 240.35 g/mol, XLogP of 1.53, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanimine;4-methyl-3-[3-(propylamino)propyl]-1H-imidazol-2-one is sourced from PubChem (CID 143217146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).