C18H20N2O3 — CID 143217863
4-[[(Z)-2-(5-methoxycyclohepta-1,4,6-trien-1-yl)ethylideneamino]-methylamino]benzoic acid (PubChem CID 143217863) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is 4-[[(Z)-2-(5-methoxycyclohepta-1,4,6-trien-1-yl)ethylideneamino]-methylamino]benzoic acid.
| Compound Name | 4-[[(Z)-2-(5-methoxycyclohepta-1,4,6-trien-1-yl)ethylideneamino]-methylamino]benzoic acid |
|---|---|
| PubChem CID | 143217863 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 4-[[(Z)-2-(5-methoxycyclohepta-1,4,6-trien-1-yl)ethylideneamino]-methylamino]benzoic acid |
| SMILES | COC1=CCC=C(C/C=N\N(C)c2ccc(C(=O)O)cc2)C=C1 |
| InChI | InChI=1S/C18H20N2O3/c1-20(16-9-7-15(8-10-16)18(21)22)19-13-12-14-4-3-5-17(23-2)11-6-14/h4-11,13H,3,12H2,1-2H3,(H,21,22)/b19-13- |
| InChIKey | NBGGLNVRPOEACS-UYRXBGFRSA-N |
| XLogP | 3.61 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|