About 4-[5-(4-methoxy-3-methylphenyl)pyrazol-1-yl]aniline;3-methyloxolane
4-[5-(4-methoxy-3-methylphenyl)pyrazol-1-yl]aniline;3-methyloxolane (PubChem CID 143218422) has the molecular formula C22H27N3O2
and a molecular weight of 365.48 g/mol. Its IUPAC name is 4-[5-(4-methoxy-3-methylphenyl)pyrazol-1-yl]aniline;3-methyloxolane.
Molecular Properties
| Compound Name | 4-[5-(4-methoxy-3-methylphenyl)pyrazol-1-yl]aniline;3-methyloxolane |
| PubChem CID | 143218422 |
| Molecular Formula | C22H27N3O2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 4-[5-(4-methoxy-3-methylphenyl)pyrazol-1-yl]aniline;3-methyloxolane |
| SMILES | CC1CCOC1.COc1ccc(-c2ccnn2-c2ccc(N)cc2)cc1C |
| InChI | InChI=1S/C17H17N3O.C5H10O/c1-12-11-13(3-8-17(12)21-2)16-9-10-19-20(16)15-6-4-14(18)5-7-15;1-5-2-3-6-4-5/h3-11H,18H2,1-2H3;5H,2-4H2,1H3 |
| InChIKey | HUYMJMSIYNDOAD-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(4-methoxy-3-methylphenyl)pyrazol-1-yl]aniline;3-methyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(4-methoxy-3-methylphenyl)pyrazol-1-yl]aniline;3-methyloxolane?
The IUPAC name of 4-[5-(4-methoxy-3-methylphenyl)pyrazol-1-yl]aniline;3-methyloxolane (CID 143218422) is 4-[5-(4-methoxy-3-methylphenyl)pyrazol-1-yl]aniline;3-methyloxolane.
What is the SMILES notation for 4-[5-(4-methoxy-3-methylphenyl)pyrazol-1-yl]aniline;3-methyloxolane?
The canonical SMILES for 4-[5-(4-methoxy-3-methylphenyl)pyrazol-1-yl]aniline;3-methyloxolane is CC1CCOC1.COc1ccc(-c2ccnn2-c2ccc(N)cc2)cc1C.
What is the InChIKey of 4-[5-(4-methoxy-3-methylphenyl)pyrazol-1-yl]aniline;3-methyloxolane?
The InChIKey is HUYMJMSIYNDOAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17N3O.C5H10O/c1-12-11-13(3-8-17(12)21-2)16-9-10-19-20(16)15-6-4-14(18)5-7-15;1-5-2-3-6-4-5/h3-11H,18H2,1-2H3;5H,2-4H2,1H3.
What are the key properties of 4-[5-(4-methoxy-3-methylphenyl)pyrazol-1-yl]aniline;3-methyloxolane?
4-[5-(4-methoxy-3-methylphenyl)pyrazol-1-yl]aniline;3-methyloxolane has a molecular weight of 365.48 g/mol, XLogP of 4.48, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(4-methoxy-3-methylphenyl)pyrazol-1-yl]aniline;3-methyloxolane is sourced from PubChem (CID 143218422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).