C17H25BN2O4 — CID 143218805
[[1-(2,2-dimethylpropanoyl)pyrrolidine-2-carbonyl]amino]methoxy-phenylborinic acid (PubChem CID 143218805) has the molecular formula C17H25BN2O4 and a molecular weight of 332.21 g/mol. Its IUPAC name is [[1-(2,2-dimethylpropanoyl)pyrrolidine-2-carbonyl]amino]methoxy-phenylborinic acid.
| Compound Name | [[1-(2,2-dimethylpropanoyl)pyrrolidine-2-carbonyl]amino]methoxy-phenylborinic acid |
|---|---|
| PubChem CID | 143218805 |
| Molecular Formula | C17H25BN2O4 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | [[1-(2,2-dimethylpropanoyl)pyrrolidine-2-carbonyl]amino]methoxy-phenylborinic acid |
| SMILES | CC(C)(C)C(=O)N1CCCC1C(=O)NCOB(O)c1ccccc1 |
| InChI | InChI=1S/C17H25BN2O4/c1-17(2,3)16(22)20-11-7-10-14(20)15(21)19-12-24-18(23)13-8-5-4-6-9-13/h4-6,8-9,14,23H,7,10-12H2,1-3H3,(H,19,21) |
| InChIKey | JETNFOLXSPBCTL-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|