About 3,4-bis(ethenyl)-1-methyl-2,5-dihydropyrrole;ethane
3,4-bis(ethenyl)-1-methyl-2,5-dihydropyrrole;ethane (PubChem CID 143218886) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 3,4-bis(ethenyl)-1-methyl-2,5-dihydropyrrole;ethane.
Molecular Properties
| Compound Name | 3,4-bis(ethenyl)-1-methyl-2,5-dihydropyrrole;ethane |
| PubChem CID | 143218886 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 3,4-bis(ethenyl)-1-methyl-2,5-dihydropyrrole;ethane |
| SMILES | C=CC1=C(C=C)CN(C)C1.CC |
| InChI | InChI=1S/C9H13N.C2H6/c1-4-8-6-10(3)7-9(8)5-2;1-2/h4-5H,1-2,6-7H2,3H3;1-2H3 |
| InChIKey | JLCZWEVWPMTUTP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-bis(ethenyl)-1-methyl-2,5-dihydropyrrole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(ethenyl)-1-methyl-2,5-dihydropyrrole;ethane?
The IUPAC name of 3,4-bis(ethenyl)-1-methyl-2,5-dihydropyrrole;ethane (CID 143218886) is 3,4-bis(ethenyl)-1-methyl-2,5-dihydropyrrole;ethane.
What is the SMILES notation for 3,4-bis(ethenyl)-1-methyl-2,5-dihydropyrrole;ethane?
The canonical SMILES for 3,4-bis(ethenyl)-1-methyl-2,5-dihydropyrrole;ethane is C=CC1=C(C=C)CN(C)C1.CC.
What is the InChIKey of 3,4-bis(ethenyl)-1-methyl-2,5-dihydropyrrole;ethane?
The InChIKey is JLCZWEVWPMTUTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N.C2H6/c1-4-8-6-10(3)7-9(8)5-2;1-2/h4-5H,1-2,6-7H2,3H3;1-2H3.
What are the key properties of 3,4-bis(ethenyl)-1-methyl-2,5-dihydropyrrole;ethane?
3,4-bis(ethenyl)-1-methyl-2,5-dihydropyrrole;ethane has a molecular weight of 165.28 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(ethenyl)-1-methyl-2,5-dihydropyrrole;ethane is sourced from PubChem (CID 143218886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).