C15H22F3N3O — CID 143219244
2-propan-2-yl-4-(4,4,4-trifluorobutoxy)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine (PubChem CID 143219244) has the molecular formula C15H22F3N3O and a molecular weight of 317.36 g/mol. Its IUPAC name is 2-propan-2-yl-4-(4,4,4-trifluorobutoxy)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine.
| Compound Name | 2-propan-2-yl-4-(4,4,4-trifluorobutoxy)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine |
|---|---|
| PubChem CID | 143219244 |
| Molecular Formula | C15H22F3N3O |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 2-propan-2-yl-4-(4,4,4-trifluorobutoxy)-6,7,8,9-tetrahydro-5H-pyrimido[4,5-d]azepine |
| SMILES | CC(C)c1nc2c(c(OCCCC(F)(F)F)n1)CCNCC2 |
| InChI | InChI=1S/C15H22F3N3O/c1-10(2)13-20-12-5-8-19-7-4-11(12)14(21-13)22-9-3-6-15(16,17)18/h10,19H,3-9H2,1-2H3 |
| InChIKey | VXHOFCUYUOPDKE-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|