C10H11N5S — CID 143219637
methyl (5Z)-3-methyl-N-(methylideneamino)-2H-pyrazolo[3,4-b]pyridine-5-carboximidothioate (PubChem CID 143219637) has the molecular formula C10H11N5S and a molecular weight of 233.30 g/mol. Its IUPAC name is methyl (5Z)-3-methyl-N-(methylideneamino)-2H-pyrazolo[3,4-b]pyridine-5-carboximidothioate.
| Compound Name | methyl (5Z)-3-methyl-N-(methylideneamino)-2H-pyrazolo[3,4-b]pyridine-5-carboximidothioate |
|---|---|
| PubChem CID | 143219637 |
| Molecular Formula | C10H11N5S |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | methyl (5Z)-3-methyl-N-(methylideneamino)-2H-pyrazolo[3,4-b]pyridine-5-carboximidothioate |
| SMILES | C=N/N=C(\SC)c1cnc2n[nH]c(C)c2c1 |
| InChI | InChI=1S/C10H11N5S/c1-6-8-4-7(10(16-3)15-11-2)5-12-9(8)14-13-6/h4-5H,2H2,1,3H3,(H,12,13,14)/b15-10- |
| InChIKey | BYOXHZZRAHJORX-GDNBJRDFSA-N |
| XLogP | 1.99 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|