C22H29N3O2 — CID 143220228
ethane;4-[[2-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethylamino]methyl]benzonitrile (PubChem CID 143220228) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is ethane;4-[[2-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethylamino]methyl]benzonitrile.
| Compound Name | ethane;4-[[2-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 143220228 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | ethane;4-[[2-(2,2,8-trimethyl-4H-[1,3]dioxino[4,5-c]pyridin-5-yl)ethylamino]methyl]benzonitrile |
| SMILES | CC.Cc1ncc(CCNCc2ccc(C#N)cc2)c2c1OC(C)(C)OC2 |
| InChI | InChI=1S/C20H23N3O2.C2H6/c1-14-19-18(13-24-20(2,3)25-19)17(12-23-14)8-9-22-11-16-6-4-15(10-21)5-7-16;1-2/h4-7,12,22H,8-9,11,13H2,1-3H3;1-2H3 |
| InChIKey | VUMYEDJCODIOHD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|