About (2E)-2-ethenyl-4-formylpenta-2,4-dienenitrile
(2E)-2-ethenyl-4-formylpenta-2,4-dienenitrile (PubChem CID 143220248) has the molecular formula C8H7NO
and a molecular weight of 133.15 g/mol. Its IUPAC name is (2E)-2-ethenyl-4-formylpenta-2,4-dienenitrile.
Molecular Properties
| Compound Name | (2E)-2-ethenyl-4-formylpenta-2,4-dienenitrile |
| PubChem CID | 143220248 |
| Molecular Formula | C8H7NO |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | (2E)-2-ethenyl-4-formylpenta-2,4-dienenitrile |
| SMILES | C=C/C(C#N)=C\C(=C)C=O |
| InChI | InChI=1S/C8H7NO/c1-3-8(5-9)4-7(2)6-10/h3-4,6H,1-2H2/b8-4+ |
| InChIKey | ZPVNXBJHFXCTKV-XBXARRHUSA-N |
| XLogP | 1.38 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-ethenyl-4-formylpenta-2,4-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-ethenyl-4-formylpenta-2,4-dienenitrile?
The IUPAC name of (2E)-2-ethenyl-4-formylpenta-2,4-dienenitrile (CID 143220248) is (2E)-2-ethenyl-4-formylpenta-2,4-dienenitrile.
What is the SMILES notation for (2E)-2-ethenyl-4-formylpenta-2,4-dienenitrile?
The canonical SMILES for (2E)-2-ethenyl-4-formylpenta-2,4-dienenitrile is C=C/C(C#N)=C\C(=C)C=O.
What is the InChIKey of (2E)-2-ethenyl-4-formylpenta-2,4-dienenitrile?
The InChIKey is ZPVNXBJHFXCTKV-XBXARRHUSA-N. The full InChI is InChI=1S/C8H7NO/c1-3-8(5-9)4-7(2)6-10/h3-4,6H,1-2H2/b8-4+.
What are the key properties of (2E)-2-ethenyl-4-formylpenta-2,4-dienenitrile?
(2E)-2-ethenyl-4-formylpenta-2,4-dienenitrile has a molecular weight of 133.15 g/mol, XLogP of 1.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-ethenyl-4-formylpenta-2,4-dienenitrile is sourced from PubChem (CID 143220248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).