C18H20BrN5O — CID 143220475
5-[3-(4-bromo-2-methylanilino)-4-pyridinyl]-N-ethyl-1,3,4-oxadiazol-2-amine;ethene (PubChem CID 143220475) has the molecular formula C18H20BrN5O and a molecular weight of 402.30 g/mol. Its IUPAC name is 5-[3-(4-bromo-2-methylanilino)-4-pyridinyl]-N-ethyl-1,3,4-oxadiazol-2-amine;ethene.
| Compound Name | 5-[3-(4-bromo-2-methylanilino)-4-pyridinyl]-N-ethyl-1,3,4-oxadiazol-2-amine;ethene |
|---|---|
| PubChem CID | 143220475 |
| Molecular Formula | C18H20BrN5O |
| Molecular Weight | 402.30 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | 5-[3-(4-bromo-2-methylanilino)-4-pyridinyl]-N-ethyl-1,3,4-oxadiazol-2-amine;ethene |
| SMILES | C=C.CCNc1nnc(-c2ccncc2Nc2ccc(Br)cc2C)o1 |
| InChI | InChI=1S/C16H16BrN5O.C2H4/c1-3-19-16-22-21-15(23-16)12-6-7-18-9-14(12)20-13-5-4-11(17)8-10(13)2;1-2/h4-9,20H,3H2,1-2H3,(H,19,22);1-2H2 |
| InChIKey | HSVQAPFMUJKUFZ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.30 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|