C7H17N3 — CID 143220567
(Z)-1-N,1-N,4-N-trimethylbut-1-ene-1,2,4-triamine (PubChem CID 143220567) has the molecular formula C7H17N3 and a molecular weight of 143.23 g/mol. Its IUPAC name is (Z)-1-N,1-N,4-N-trimethylbut-1-ene-1,2,4-triamine.
| Compound Name | (Z)-1-N,1-N,4-N-trimethylbut-1-ene-1,2,4-triamine |
|---|---|
| PubChem CID | 143220567 |
| Molecular Formula | C7H17N3 |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.14 |
| IUPAC Name | (Z)-1-N,1-N,4-N-trimethylbut-1-ene-1,2,4-triamine |
| SMILES | CNCC/C(N)=C/N(C)C |
| InChI | InChI=1S/C7H17N3/c1-9-5-4-7(8)6-10(2)3/h6,9H,4-5,8H2,1-3H3/b7-6- |
| InChIKey | JVINAURXWHRXRZ-SREVYHEPSA-N |
| XLogP | -0.04 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |