C22H35N9O3 — CID 143220941
6-[2-(2-ethoxyethoxy)ethanimidoyl]-5-N-(2-ethoxyethyl)-2-piperazin-1-yl-4-N-pyrimidin-4-ylpyrimidine-4,5-diamine (PubChem CID 143220941) has the molecular formula C22H35N9O3 and a molecular weight of 473.58 g/mol. Its IUPAC name is 6-[2-(2-ethoxyethoxy)ethanimidoyl]-5-N-(2-ethoxyethyl)-2-piperazin-1-yl-4-N-pyrimidin-4-ylpyrimidine-4,5-diamine.
| Compound Name | 6-[2-(2-ethoxyethoxy)ethanimidoyl]-5-N-(2-ethoxyethyl)-2-piperazin-1-yl-4-N-pyrimidin-4-ylpyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 143220941 |
| Molecular Formula | C22H35N9O3 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | 6-[2-(2-ethoxyethoxy)ethanimidoyl]-5-N-(2-ethoxyethyl)-2-piperazin-1-yl-4-N-pyrimidin-4-ylpyrimidine-4,5-diamine |
| SMILES | [H]/N=C(\COCCOCC)c1nc(N2CCNCC2)nc(Nc2ccncn2)c1NCCOCC |
| InChI | InChI=1S/C22H35N9O3/c1-3-32-12-9-26-20-19(17(23)15-34-14-13-33-4-2)29-22(31-10-7-24-8-11-31)30-21(20)28-18-5-6-25-16-27-18/h5-6,16,23-24,26H,3-4,7-15H2,1-2H3,(H,25,27,28,29,30)/b23-17+ |
| InChIKey | IMBULLDTQCKIDL-HAVVHWLPSA-N |
| XLogP | 1.29 |
| TPSA | 142.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|