C9H18N2OS — CID 143221289
4-(propylamino)piperidine-1-carbothioic S-acid (PubChem CID 143221289) has the molecular formula C9H18N2OS and a molecular weight of 202.32 g/mol. Its IUPAC name is 4-(propylamino)piperidine-1-carbothioic S-acid.
| Compound Name | 4-(propylamino)piperidine-1-carbothioic S-acid |
|---|---|
| PubChem CID | 143221289 |
| Molecular Formula | C9H18N2OS |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 4-(propylamino)piperidine-1-carbothioic S-acid |
| SMILES | CCCNC1CCN(C(=O)S)CC1 |
| InChI | InChI=1S/C9H18N2OS/c1-2-5-10-8-3-6-11(7-4-8)9(12)13/h8,10H,2-7H2,1H3,(H,12,13) |
| InChIKey | PFIDSLVSUJJOFP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|