About [4-methyl-7-[(Z)-3-methylbut-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine
[4-methyl-7-[(Z)-3-methylbut-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine (PubChem CID 143221508) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is [4-methyl-7-[(Z)-3-methylbut-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine.
Molecular Properties
| Compound Name | [4-methyl-7-[(Z)-3-methylbut-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine |
| PubChem CID | 143221508 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | [4-methyl-7-[(Z)-3-methylbut-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine |
| SMILES | [H]/N=C/C1=CC=C(C)CC=C1/C=C\C(C)C |
| InChI | InChI=1S/C14H19N/c1-11(2)4-7-13-8-5-12(3)6-9-14(13)10-15/h4,6-11,15H,5H2,1-3H3/b7-4-,15-10+ |
| InChIKey | FAPSGTRGXPJGPI-NNGUFLQMSA-N |
| XLogP | 4.05 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [4-methyl-7-[(Z)-3-methylbut-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methyl-7-[(Z)-3-methylbut-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine?
The IUPAC name of [4-methyl-7-[(Z)-3-methylbut-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine (CID 143221508) is [4-methyl-7-[(Z)-3-methylbut-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine.
What is the SMILES notation for [4-methyl-7-[(Z)-3-methylbut-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine?
The canonical SMILES for [4-methyl-7-[(Z)-3-methylbut-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine is [H]/N=C/C1=CC=C(C)CC=C1/C=C\C(C)C.
What is the InChIKey of [4-methyl-7-[(Z)-3-methylbut-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine?
The InChIKey is FAPSGTRGXPJGPI-NNGUFLQMSA-N. The full InChI is InChI=1S/C14H19N/c1-11(2)4-7-13-8-5-12(3)6-9-14(13)10-15/h4,6-11,15H,5H2,1-3H3/b7-4-,15-10+.
What are the key properties of [4-methyl-7-[(Z)-3-methylbut-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine?
[4-methyl-7-[(Z)-3-methylbut-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine has a molecular weight of 201.31 g/mol, XLogP of 4.05, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methyl-7-[(Z)-3-methylbut-1-enyl]cyclohepta-1,3,6-trien-1-yl]methanimine is sourced from PubChem (CID 143221508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).