C16H22N2O2 — CID 143221648
1-(3-methylbut-2-enyl)-2-oxo-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-3-carboxamide (PubChem CID 143221648) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-(3-methylbut-2-enyl)-2-oxo-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-3-carboxamide.
| Compound Name | 1-(3-methylbut-2-enyl)-2-oxo-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 143221648 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-(3-methylbut-2-enyl)-2-oxo-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine-3-carboxamide |
| SMILES | CC(C)=CCn1c2c(cc(C(N)=O)c1=O)CCCCC2 |
| InChI | InChI=1S/C16H22N2O2/c1-11(2)8-9-18-14-7-5-3-4-6-12(14)10-13(15(17)19)16(18)20/h8,10H,3-7,9H2,1-2H3,(H2,17,19) |
| InChIKey | YXDORCNCIOLWKR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|