C16H15NO — CID 14322179
(1R,8R,9S)-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-8-ol (PubChem CID 14322179) has the molecular formula C16H15NO and a molecular weight of 237.30 g/mol. Its IUPAC name is (1R,8R,9S)-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-8-ol.
| Compound Name | (1R,8R,9S)-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-8-ol |
|---|---|
| PubChem CID | 14322179 |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (1R,8R,9S)-1-methyl-16-azatetracyclo[7.6.1.02,7.010,15]hexadeca-2,4,6,10,12,14-hexaen-8-ol |
| SMILES | C[C@@]12N[C@@H](c3ccccc31)[C@H](O)c1ccccc12 |
| InChI | InChI=1S/C16H15NO/c1-16-12-8-4-2-6-10(12)14(17-16)15(18)11-7-3-5-9-13(11)16/h2-9,14-15,17-18H,1H3/t14-,15+,16+/m0/s1 |
| InChIKey | ICNAEBGGDVSIIR-ARFHVFGLSA-N |
| XLogP | 2.64 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |