About ethane;formaldehyde;1-[2-methyl-5-(4-methylanilino)-1-benzofuran-3-yl]ethanone
ethane;formaldehyde;1-[2-methyl-5-(4-methylanilino)-1-benzofuran-3-yl]ethanone (PubChem CID 143221810) has the molecular formula C22H27NO4
and a molecular weight of 369.46 g/mol. Its IUPAC name is ethane;formaldehyde;1-[2-methyl-5-(4-methylanilino)-1-benzofuran-3-yl]ethanone.
Molecular Properties
| Compound Name | ethane;formaldehyde;1-[2-methyl-5-(4-methylanilino)-1-benzofuran-3-yl]ethanone |
| PubChem CID | 143221810 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | ethane;formaldehyde;1-[2-methyl-5-(4-methylanilino)-1-benzofuran-3-yl]ethanone |
| SMILES | C=O.C=O.CC.CC(=O)c1c(C)oc2ccc(Nc3ccc(C)cc3)cc12 |
| InChI | InChI=1S/C18H17NO2.C2H6.2CH2O/c1-11-4-6-14(7-5-11)19-15-8-9-17-16(10-15)18(12(2)20)13(3)21-17;3*1-2/h4-10,19H,1-3H3;1-2H3;2*1H2 |
| InChIKey | YGRONJZXBHOMAZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethane;formaldehyde;1-[2-methyl-5-(4-methylanilino)-1-benzofuran-3-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;formaldehyde;1-[2-methyl-5-(4-methylanilino)-1-benzofuran-3-yl]ethanone?
The IUPAC name of ethane;formaldehyde;1-[2-methyl-5-(4-methylanilino)-1-benzofuran-3-yl]ethanone (CID 143221810) is ethane;formaldehyde;1-[2-methyl-5-(4-methylanilino)-1-benzofuran-3-yl]ethanone.
What is the SMILES notation for ethane;formaldehyde;1-[2-methyl-5-(4-methylanilino)-1-benzofuran-3-yl]ethanone?
The canonical SMILES for ethane;formaldehyde;1-[2-methyl-5-(4-methylanilino)-1-benzofuran-3-yl]ethanone is C=O.C=O.CC.CC(=O)c1c(C)oc2ccc(Nc3ccc(C)cc3)cc12.
What is the InChIKey of ethane;formaldehyde;1-[2-methyl-5-(4-methylanilino)-1-benzofuran-3-yl]ethanone?
The InChIKey is YGRONJZXBHOMAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17NO2.C2H6.2CH2O/c1-11-4-6-14(7-5-11)19-15-8-9-17-16(10-15)18(12(2)20)13(3)21-17;3*1-2/h4-10,19H,1-3H3;1-2H3;2*1H2.
What are the key properties of ethane;formaldehyde;1-[2-methyl-5-(4-methylanilino)-1-benzofuran-3-yl]ethanone?
ethane;formaldehyde;1-[2-methyl-5-(4-methylanilino)-1-benzofuran-3-yl]ethanone has a molecular weight of 369.46 g/mol, XLogP of 5.65, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;formaldehyde;1-[2-methyl-5-(4-methylanilino)-1-benzofuran-3-yl]ethanone is sourced from PubChem (CID 143221810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).