About 3-(5-propylcyclohepta-1,4,6-trien-1-yl)pyridine
3-(5-propylcyclohepta-1,4,6-trien-1-yl)pyridine (PubChem CID 143222162) has the molecular formula C15H17N
and a molecular weight of 211.31 g/mol. Its IUPAC name is 3-(5-propylcyclohepta-1,4,6-trien-1-yl)pyridine.
Molecular Properties
| Compound Name | 3-(5-propylcyclohepta-1,4,6-trien-1-yl)pyridine |
| PubChem CID | 143222162 |
| Molecular Formula | C15H17N |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | 3-(5-propylcyclohepta-1,4,6-trien-1-yl)pyridine |
| SMILES | CCCC1=CCC=C(c2cccnc2)C=C1 |
| InChI | InChI=1S/C15H17N/c1-2-5-13-6-3-7-14(10-9-13)15-8-4-11-16-12-15/h4,6-12H,2-3,5H2,1H3 |
| InChIKey | IRMIBLNPVLOQHH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(5-propylcyclohepta-1,4,6-trien-1-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-propylcyclohepta-1,4,6-trien-1-yl)pyridine?
The IUPAC name of 3-(5-propylcyclohepta-1,4,6-trien-1-yl)pyridine (CID 143222162) is 3-(5-propylcyclohepta-1,4,6-trien-1-yl)pyridine.
What is the SMILES notation for 3-(5-propylcyclohepta-1,4,6-trien-1-yl)pyridine?
The canonical SMILES for 3-(5-propylcyclohepta-1,4,6-trien-1-yl)pyridine is CCCC1=CCC=C(c2cccnc2)C=C1.
What is the InChIKey of 3-(5-propylcyclohepta-1,4,6-trien-1-yl)pyridine?
The InChIKey is IRMIBLNPVLOQHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N/c1-2-5-13-6-3-7-14(10-9-13)15-8-4-11-16-12-15/h4,6-12H,2-3,5H2,1H3.
What are the key properties of 3-(5-propylcyclohepta-1,4,6-trien-1-yl)pyridine?
3-(5-propylcyclohepta-1,4,6-trien-1-yl)pyridine has a molecular weight of 211.31 g/mol, XLogP of 4.15, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-propylcyclohepta-1,4,6-trien-1-yl)pyridine is sourced from PubChem (CID 143222162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).