C28H30N5O5P — CID 143223118
4-(diethoxyphosphorylmethoxy)-N-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide (PubChem CID 143223118) has the molecular formula C28H30N5O5P and a molecular weight of 547.55 g/mol. Its IUPAC name is 4-(diethoxyphosphorylmethoxy)-N-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide.
| Compound Name | 4-(diethoxyphosphorylmethoxy)-N-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 143223118 |
| Molecular Formula | C28H30N5O5P |
| Molecular Weight | 547.55 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | 4-(diethoxyphosphorylmethoxy)-N-[4-methyl-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide |
| SMILES | CCOP(=O)(COc1ccc(C(=O)Nc2ccc(C)c(Nc3nccc(-c4cccnc4)n3)c2)cc1)OCC |
| InChI | InChI=1S/C28H30N5O5P/c1-4-37-39(35,38-5-2)19-36-24-12-9-21(10-13-24)27(34)31-23-11-8-20(3)26(17-23)33-28-30-16-14-25(32-28)22-7-6-15-29-18-22/h6-18H,4-5,19H2,1-3H3,(H,31,34)(H,30,32,33) |
| InChIKey | QSFRIEAGQJEHCC-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.55 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|