C13H16FN3O2 — CID 143223396
1-[1-(3-fluoro-4-methylphenyl)imidazol-2-yl]-N-methylmethanamine;formic acid (PubChem CID 143223396) has the molecular formula C13H16FN3O2 and a molecular weight of 265.29 g/mol. Its IUPAC name is 1-[1-(3-fluoro-4-methylphenyl)imidazol-2-yl]-N-methylmethanamine;formic acid.
| Compound Name | 1-[1-(3-fluoro-4-methylphenyl)imidazol-2-yl]-N-methylmethanamine;formic acid |
|---|---|
| PubChem CID | 143223396 |
| Molecular Formula | C13H16FN3O2 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 1-[1-(3-fluoro-4-methylphenyl)imidazol-2-yl]-N-methylmethanamine;formic acid |
| SMILES | CNCc1nccn1-c1ccc(C)c(F)c1.O=CO |
| InChI | InChI=1S/C12H14FN3.CH2O2/c1-9-3-4-10(7-11(9)13)16-6-5-15-12(16)8-14-2;2-1-3/h3-7,14H,8H2,1-2H3;1H,(H,2,3) |
| InChIKey | UGMMECJETUUTJR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|