C10H17NO2 — CID 143223439
(2Z,4E)-5-(2-methoxyethoxy)hepta-2,4,6-trien-1-amine (PubChem CID 143223439) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (2Z,4E)-5-(2-methoxyethoxy)hepta-2,4,6-trien-1-amine.
| Compound Name | (2Z,4E)-5-(2-methoxyethoxy)hepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 143223439 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (2Z,4E)-5-(2-methoxyethoxy)hepta-2,4,6-trien-1-amine |
| SMILES | C=C/C(=C\C=C/CN)OCCOC |
| InChI | InChI=1S/C10H17NO2/c1-3-10(6-4-5-7-11)13-9-8-12-2/h3-6H,1,7-9,11H2,2H3/b5-4-,10-6+ |
| InChIKey | IUAOXRHRLRTDIC-VWJYOPCBSA-N |
| XLogP | 1.23 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|