C29H37FN4O6 — CID 143223800
N-(2,3-dihydroxypropyl)-N-methylcyclopropanecarboxamide;(Z)-N-ethenyl-N-(3-fluoro-4-formamidophenyl)but-2-enamide;N-(4-methylphenyl)formamide (PubChem CID 143223800) has the molecular formula C29H37FN4O6 and a molecular weight of 556.64 g/mol. Its IUPAC name is N-(2,3-dihydroxypropyl)-N-methylcyclopropanecarboxamide;(Z)-N-ethenyl-N-(3-fluoro-4-formamidophenyl)but-2-enamide;N-(4-methylphenyl)formamide.
| Compound Name | N-(2,3-dihydroxypropyl)-N-methylcyclopropanecarboxamide;(Z)-N-ethenyl-N-(3-fluoro-4-formamidophenyl)but-2-enamide;N-(4-methylphenyl)formamide |
|---|---|
| PubChem CID | 143223800 |
| Molecular Formula | C29H37FN4O6 |
| Molecular Weight | 556.64 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | N-(2,3-dihydroxypropyl)-N-methylcyclopropanecarboxamide;(Z)-N-ethenyl-N-(3-fluoro-4-formamidophenyl)but-2-enamide;N-(4-methylphenyl)formamide |
| SMILES | C=CN(C(=O)/C=C\C)c1ccc(NC=O)c(F)c1.CN(CC(O)CO)C(=O)C1CC1.Cc1ccc(NC=O)cc1 |
| InChI | InChI=1S/C13H13FN2O2.C8H15NO3.C8H9NO/c1-3-5-13(18)16(4-2)10-6-7-12(15-9-17)11(14)8-10;1-9(4-7(11)5-10)8(12)6-2-3-6;1-7-2-4-8(5-3-7)9-6-10/h3-9H,2H2,1H3,(H,15,17);6-7,10-11H,2-5H2,1H3;2-6H,1H3,(H,9,10)/b5-3-;; |
| InChIKey | PRPABYUNNMOVFI-ORIPCLHRSA-N |
| XLogP | 3.22 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.64 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|