About formamide;3-hydroxycyclopentane-1-carboxamide
formamide;3-hydroxycyclopentane-1-carboxamide (PubChem CID 143223866) has the molecular formula C7H14N2O3
and a molecular weight of 174.20 g/mol. Its IUPAC name is formamide;3-hydroxycyclopentane-1-carboxamide.
Molecular Properties
| Compound Name | formamide;3-hydroxycyclopentane-1-carboxamide |
| PubChem CID | 143223866 |
| Molecular Formula | C7H14N2O3 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | formamide;3-hydroxycyclopentane-1-carboxamide |
| SMILES | NC(=O)C1CCC(O)C1.NC=O |
| InChI | InChI=1S/C6H11NO2.CH3NO/c7-6(9)4-1-2-5(8)3-4;2-1-3/h4-5,8H,1-3H2,(H2,7,9);1H,(H2,2,3) |
| InChIKey | WYSCWKJRPFFRDI-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze formamide;3-hydroxycyclopentane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formamide;3-hydroxycyclopentane-1-carboxamide?
The IUPAC name of formamide;3-hydroxycyclopentane-1-carboxamide (CID 143223866) is formamide;3-hydroxycyclopentane-1-carboxamide.
What is the SMILES notation for formamide;3-hydroxycyclopentane-1-carboxamide?
The canonical SMILES for formamide;3-hydroxycyclopentane-1-carboxamide is NC(=O)C1CCC(O)C1.NC=O.
What is the InChIKey of formamide;3-hydroxycyclopentane-1-carboxamide?
The InChIKey is WYSCWKJRPFFRDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.CH3NO/c7-6(9)4-1-2-5(8)3-4;2-1-3/h4-5,8H,1-3H2,(H2,7,9);1H,(H2,2,3).
What are the key properties of formamide;3-hydroxycyclopentane-1-carboxamide?
formamide;3-hydroxycyclopentane-1-carboxamide has a molecular weight of 174.20 g/mol, XLogP of -1.27, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formamide;3-hydroxycyclopentane-1-carboxamide is sourced from PubChem (CID 143223866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).