C31H37N3O8 — CID 143223921
benzyl N-(phenylmethoxycarbonylamino)carbamate;methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate (PubChem CID 143223921) has the molecular formula C31H37N3O8 and a molecular weight of 579.65 g/mol. Its IUPAC name is benzyl N-(phenylmethoxycarbonylamino)carbamate;methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate.
| Compound Name | benzyl N-(phenylmethoxycarbonylamino)carbamate;methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 143223921 |
| Molecular Formula | C31H37N3O8 |
| Molecular Weight | 579.65 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | benzyl N-(phenylmethoxycarbonylamino)carbamate;methyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylpropanoate |
| SMILES | COC(=O)CC(NC(=O)OC(C)(C)C)c1ccccc1.O=C(NNC(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C16H16N2O4.C15H21NO4/c19-15(21-11-13-7-3-1-4-8-13)17-18-16(20)22-12-14-9-5-2-6-10-14;1-15(2,3)20-14(18)16-12(10-13(17)19-4)11-8-6-5-7-9-11/h1-10H,11-12H2,(H,17,19)(H,18,20);5-9,12H,10H2,1-4H3,(H,16,18) |
| InChIKey | GTLZEQLVIHUNDS-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.65 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|