About 3-fluoro-1-methylpyrrole
3-fluoro-1-methylpyrrole (PubChem CID 14322401) has the molecular formula C5H6FN
and a molecular weight of 99.11 g/mol. Its IUPAC name is 3-fluoro-1-methylpyrrole.
Molecular Properties
| Compound Name | 3-fluoro-1-methylpyrrole |
| PubChem CID | 14322401 |
| Molecular Formula | C5H6FN |
| Molecular Weight | 99.11 g/mol |
| Exact Mass | 99.05 |
| IUPAC Name | 3-fluoro-1-methylpyrrole |
| SMILES | Cn1ccc(F)c1 |
| InChI | InChI=1S/C5H6FN/c1-7-3-2-5(6)4-7/h2-4H,1H3 |
| InChIKey | AVFZRMJJOLOUJL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.11 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-1-methylpyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-1-methylpyrrole?
The IUPAC name of 3-fluoro-1-methylpyrrole (CID 14322401) is 3-fluoro-1-methylpyrrole.
What is the SMILES notation for 3-fluoro-1-methylpyrrole?
The canonical SMILES for 3-fluoro-1-methylpyrrole is Cn1ccc(F)c1.
What is the InChIKey of 3-fluoro-1-methylpyrrole?
The InChIKey is AVFZRMJJOLOUJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6FN/c1-7-3-2-5(6)4-7/h2-4H,1H3.
What are the key properties of 3-fluoro-1-methylpyrrole?
3-fluoro-1-methylpyrrole has a molecular weight of 99.11 g/mol, XLogP of 1.16, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-1-methylpyrrole is sourced from PubChem (CID 14322401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).