C16H28N2O2 — CID 143224152
N-ethyl-N-methylformamide;1-(4-methoxycyclohepta-1,4,6-trien-1-yl)-N,N-dimethylethanamine (PubChem CID 143224152) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is N-ethyl-N-methylformamide;1-(4-methoxycyclohepta-1,4,6-trien-1-yl)-N,N-dimethylethanamine.
| Compound Name | N-ethyl-N-methylformamide;1-(4-methoxycyclohepta-1,4,6-trien-1-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 143224152 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | N-ethyl-N-methylformamide;1-(4-methoxycyclohepta-1,4,6-trien-1-yl)-N,N-dimethylethanamine |
| SMILES | CCN(C)C=O.COC1=CC=CC(C(C)N(C)C)=CC1 |
| InChI | InChI=1S/C12H19NO.C4H9NO/c1-10(13(2)3)11-6-5-7-12(14-4)9-8-11;1-3-5(2)4-6/h5-8,10H,9H2,1-4H3;4H,3H2,1-2H3 |
| InChIKey | ZKFOUWYPDIDMOB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|