C19H27N3OS — CID 143224255
2-[4-(pyridin-2-ylmethyl)piperidin-1-yl]-N-(6-sulfanylidenehex-4-en-2-yl)acetamide (PubChem CID 143224255) has the molecular formula C19H27N3OS and a molecular weight of 345.51 g/mol. Its IUPAC name is 2-[4-(pyridin-2-ylmethyl)piperidin-1-yl]-N-(6-sulfanylidenehex-4-en-2-yl)acetamide.
| Compound Name | 2-[4-(pyridin-2-ylmethyl)piperidin-1-yl]-N-(6-sulfanylidenehex-4-en-2-yl)acetamide |
|---|---|
| PubChem CID | 143224255 |
| Molecular Formula | C19H27N3OS |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 2-[4-(pyridin-2-ylmethyl)piperidin-1-yl]-N-(6-sulfanylidenehex-4-en-2-yl)acetamide |
| SMILES | CC(CC=CC=S)NC(=O)CN1CCC(Cc2ccccn2)CC1 |
| InChI | InChI=1S/C19H27N3OS/c1-16(6-3-5-13-24)21-19(23)15-22-11-8-17(9-12-22)14-18-7-2-4-10-20-18/h2-5,7,10,13,16-17H,6,8-9,11-12,14-15H2,1H3,(H,21,23) |
| InChIKey | DCGXVABETVSYDQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|